C33H50N4O2 — CID 139404957
(2S)-1-[8-[[2-(2,6-dimethylanilino)-2-oxoethyl]-methylamino]octyl]-N-(2,6-dimethylphenyl)piperidine-2-carboxamide (PubChem CID 139404957) has the molecular formula C33H50N4O2 and a molecular weight of 534.79 g/mol. Its IUPAC name is (2S)-1-[8-[[2-(2,6-dimethylanilino)-2-oxoethyl]-methylamino]octyl]-N-(2,6-dimethylphenyl)piperidine-2-carboxamide.
| Compound Name | (2S)-1-[8-[[2-(2,6-dimethylanilino)-2-oxoethyl]-methylamino]octyl]-N-(2,6-dimethylphenyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 139404957 |
| Molecular Formula | C33H50N4O2 |
| Molecular Weight | 534.79 g/mol |
| Exact Mass | 534.39 |
| IUPAC Name | (2S)-1-[8-[[2-(2,6-dimethylanilino)-2-oxoethyl]-methylamino]octyl]-N-(2,6-dimethylphenyl)piperidine-2-carboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)CN(C)CCCCCCCCN1CCCC[C@H]1C(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C33H50N4O2/c1-25-16-14-17-26(2)31(25)34-30(38)24-36(5)21-11-8-6-7-9-12-22-37-23-13-10-20-29(37)33(39)35-32-27(3)18-15-19-28(32)4/h14-19,29H,6-13,20-24H2,1-5H3,(H,34,38)(H,35,39)/t29-/m0/s1 |
| InChIKey | ZCVFPWISAYAUQC-LJAQVGFWSA-N |
| XLogP | 6.62 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.79 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|