C41H67N4O3S+ — CID 155036747
[2-(2,6-dimethylanilino)-2-oxoethyl]-[7-[(2S)-2-[(2,6-dimethylphenyl)carbamoyl]piperidin-1-yl]heptyl]-(5-hydroxypentyl)-(5-sulfanylpentyl)azanium (PubChem CID 155036747) has the molecular formula C41H67N4O3S+ and a molecular weight of 696.08 g/mol. Its IUPAC name is [2-(2,6-dimethylanilino)-2-oxoethyl]-[7-[(2S)-2-[(2,6-dimethylphenyl)carbamoyl]piperidin-1-yl]heptyl]-(5-hydroxypentyl)-(5-sulfanylpentyl)azanium.
| Compound Name | [2-(2,6-dimethylanilino)-2-oxoethyl]-[7-[(2S)-2-[(2,6-dimethylphenyl)carbamoyl]piperidin-1-yl]heptyl]-(5-hydroxypentyl)-(5-sulfanylpentyl)azanium |
|---|---|
| PubChem CID | 155036747 |
| Molecular Formula | C41H67N4O3S+ |
| Molecular Weight | 696.08 g/mol |
| Exact Mass | 695.49 |
| IUPAC Name | [2-(2,6-dimethylanilino)-2-oxoethyl]-[7-[(2S)-2-[(2,6-dimethylphenyl)carbamoyl]piperidin-1-yl]heptyl]-(5-hydroxypentyl)-(5-sulfanylpentyl)azanium |
| SMILES | Cc1cccc(C)c1NC(=O)C[N+](CCCCCO)(CCCCCS)CCCCCCCN1CCCC[C@H]1C(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C41H66N4O3S/c1-33-20-18-21-34(2)39(33)42-38(47)32-45(28-14-8-16-30-46,29-15-9-17-31-49)27-13-7-5-6-11-25-44-26-12-10-24-37(44)41(48)43-40-35(3)22-19-23-36(40)4/h18-23,37,46H,5-17,24-32H2,1-4H3,(H2-,42,43,47,48,49)/p+1/t37-,45?/m0/s1 |
| InChIKey | AHSKMFWRZJVXKP-IEVWRSCNSA-O |
| XLogP | 8.38 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.08 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|