C18H29N2O3+ — CID 168796151
[2-(4-acetyloxy-2,6-dimethylanilino)-2-oxoethyl]-triethylazanium (PubChem CID 168796151) has the molecular formula C18H29N2O3+ and a molecular weight of 321.44 g/mol. Its IUPAC name is [2-(4-acetyloxy-2,6-dimethylanilino)-2-oxoethyl]-triethylazanium.
| Compound Name | [2-(4-acetyloxy-2,6-dimethylanilino)-2-oxoethyl]-triethylazanium |
|---|---|
| PubChem CID | 168796151 |
| Molecular Formula | C18H29N2O3+ |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | [2-(4-acetyloxy-2,6-dimethylanilino)-2-oxoethyl]-triethylazanium |
| SMILES | CC[N+](CC)(CC)CC(=O)Nc1c(C)cc(OC(C)=O)cc1C |
| InChI | InChI=1S/C18H28N2O3/c1-7-20(8-2,9-3)12-17(22)19-18-13(4)10-16(11-14(18)5)23-15(6)21/h10-11H,7-9,12H2,1-6H3/p+1 |
| InChIKey | PHPUGKAESGBDKO-UHFFFAOYSA-O |
| XLogP | 3.04 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|