C30H50N6O2+2 — CID 145255039
[2-[4-amino-3-[[5-amino-3-methyl-2-[[2-(triethylazaniumyl)acetyl]amino]phenyl]methyl]anilino]-2-oxoethyl]-triethylazanium (PubChem CID 145255039) has the molecular formula C30H50N6O2+2 and a molecular weight of 526.77 g/mol. Its IUPAC name is [2-[4-amino-3-[[5-amino-3-methyl-2-[[2-(triethylazaniumyl)acetyl]amino]phenyl]methyl]anilino]-2-oxoethyl]-triethylazanium.
| Compound Name | [2-[4-amino-3-[[5-amino-3-methyl-2-[[2-(triethylazaniumyl)acetyl]amino]phenyl]methyl]anilino]-2-oxoethyl]-triethylazanium |
|---|---|
| PubChem CID | 145255039 |
| Molecular Formula | C30H50N6O2+2 |
| Molecular Weight | 526.77 g/mol |
| Exact Mass | 526.40 |
| IUPAC Name | [2-[4-amino-3-[[5-amino-3-methyl-2-[[2-(triethylazaniumyl)acetyl]amino]phenyl]methyl]anilino]-2-oxoethyl]-triethylazanium |
| SMILES | CC[N+](CC)(CC)CC(=O)Nc1ccc(N)c(Cc2cc(N)cc(C)c2NC(=O)C[N+](CC)(CC)CC)c1 |
| InChI | InChI=1S/C30H48N6O2/c1-8-35(9-2,10-3)20-28(37)33-26-14-15-27(32)23(19-26)17-24-18-25(31)16-22(7)30(24)34-29(38)21-36(11-4,12-5)13-6/h14-16,18-19H,8-13,17,20-21,31-32H2,1-7H3/p+2 |
| InChIKey | IPKWKEMRFNMGLP-UHFFFAOYSA-P |
| XLogP | 4.38 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.77 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|