C30H48N6O2+2 — CID 71473692
[2-[3,5-dimethyl-4-[[4-[[2-(triethylazaniumyl)acetyl]amino]phenyl]diazenyl]anilino]-2-oxoethyl]-triethylazanium (PubChem CID 71473692) has the molecular formula C30H48N6O2+2 and a molecular weight of 524.75 g/mol. Its IUPAC name is [2-[3,5-dimethyl-4-[[4-[[2-(triethylazaniumyl)acetyl]amino]phenyl]diazenyl]anilino]-2-oxoethyl]-triethylazanium.
| Compound Name | [2-[3,5-dimethyl-4-[[4-[[2-(triethylazaniumyl)acetyl]amino]phenyl]diazenyl]anilino]-2-oxoethyl]-triethylazanium |
|---|---|
| PubChem CID | 71473692 |
| Molecular Formula | C30H48N6O2+2 |
| Molecular Weight | 524.75 g/mol |
| Exact Mass | 524.38 |
| IUPAC Name | [2-[3,5-dimethyl-4-[[4-[[2-(triethylazaniumyl)acetyl]amino]phenyl]diazenyl]anilino]-2-oxoethyl]-triethylazanium |
| SMILES | CC[N+](CC)(CC)CC(=O)Nc1ccc(/N=N/c2c(C)cc(NC(=O)C[N+](CC)(CC)CC)cc2C)cc1 |
| InChI | InChI=1S/C30H46N6O2/c1-9-35(10-2,11-3)21-28(37)31-25-15-17-26(18-16-25)33-34-30-23(7)19-27(20-24(30)8)32-29(38)22-36(12-4,13-5)14-6/h15-20H,9-14,21-22H2,1-8H3/p+2 |
| InChIKey | RKAUGPFCQGRNMZ-UHFFFAOYSA-P |
| XLogP | 6.35 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.75 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|