C24H34N5O2+ — CID 44604482
[2-[4-[[4-(butanoylamino)phenyl]diazenyl]anilino]-2-oxoethyl]-triethylazanium (PubChem CID 44604482) has the molecular formula C24H34N5O2+ and a molecular weight of 424.57 g/mol. Its IUPAC name is [2-[4-[[4-(butanoylamino)phenyl]diazenyl]anilino]-2-oxoethyl]-triethylazanium.
| Compound Name | [2-[4-[[4-(butanoylamino)phenyl]diazenyl]anilino]-2-oxoethyl]-triethylazanium |
|---|---|
| PubChem CID | 44604482 |
| Molecular Formula | C24H34N5O2+ |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | [2-[4-[[4-(butanoylamino)phenyl]diazenyl]anilino]-2-oxoethyl]-triethylazanium |
| SMILES | CCCC(=O)Nc1ccc(/N=N/c2ccc(NC(=O)C[N+](CC)(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C24H33N5O2/c1-5-9-23(30)25-19-10-14-21(15-11-19)27-28-22-16-12-20(13-17-22)26-24(31)18-29(6-2,7-3)8-4/h10-17H,5-9,18H2,1-4H3,(H-,25,26,27,28,30,31)/p+1 |
| InChIKey | JHKLBTAXOVUKCX-UHFFFAOYSA-O |
| XLogP | 5.66 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|