C20H24N4O2 — CID 4526974
N-[3-(butanoylamino)-4-phenyldiazenylphenyl]butanamide (PubChem CID 4526974) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is N-[3-(butanoylamino)-4-phenyldiazenylphenyl]butanamide.
| Compound Name | N-[3-(butanoylamino)-4-phenyldiazenylphenyl]butanamide |
|---|---|
| PubChem CID | 4526974 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | N-[3-(butanoylamino)-4-phenyldiazenylphenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(/N=N/c2ccccc2)c(NC(=O)CCC)c1 |
| InChI | InChI=1S/C20H24N4O2/c1-3-8-19(25)21-16-12-13-17(18(14-16)22-20(26)9-4-2)24-23-15-10-6-5-7-11-15/h5-7,10-14H,3-4,8-9H2,1-2H3,(H,21,25)(H,22,26)/b24-23+ |
| InChIKey | WNIIFLCKJIDZJS-WCWDXBQESA-N |
| XLogP | 5.58 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|