C30H22F2N4O2 — CID 6269441
(E)-3-(4-fluorophenyl)-N-[3-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]-4-phenyldiazenylphenyl]prop-2-enamide (PubChem CID 6269441) has the molecular formula C30H22F2N4O2 and a molecular weight of 508.53 g/mol. Its IUPAC name is (E)-3-(4-fluorophenyl)-N-[3-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]-4-phenyldiazenylphenyl]prop-2-enamide.
| Compound Name | (E)-3-(4-fluorophenyl)-N-[3-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]-4-phenyldiazenylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 6269441 |
| Molecular Formula | C30H22F2N4O2 |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | (E)-3-(4-fluorophenyl)-N-[3-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]-4-phenyldiazenylphenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(F)cc1)Nc1ccc(/N=N/c2ccccc2)c(NC(=O)/C=C/c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C30H22F2N4O2/c31-23-12-6-21(7-13-23)10-18-29(37)33-26-16-17-27(36-35-25-4-2-1-3-5-25)28(20-26)34-30(38)19-11-22-8-14-24(32)15-9-22/h1-20H,(H,33,37)(H,34,38)/b18-10+,19-11+,36-35+ |
| InChIKey | CKASUWLGXDGEBC-FNWGJVEASA-N |
| XLogP | 7.68 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|