C19H20FN3O2 — CID 82034725
3-amino-N-[3-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]-4-methylphenyl]propanamide (PubChem CID 82034725) has the molecular formula C19H20FN3O2 and a molecular weight of 341.39 g/mol. Its IUPAC name is 3-amino-N-[3-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]-4-methylphenyl]propanamide.
| Compound Name | 3-amino-N-[3-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]-4-methylphenyl]propanamide |
|---|---|
| PubChem CID | 82034725 |
| Molecular Formula | C19H20FN3O2 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 3-amino-N-[3-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]-4-methylphenyl]propanamide |
| SMILES | Cc1ccc(NC(=O)CCN)cc1NC(=O)/C=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C19H20FN3O2/c1-13-2-8-16(22-19(25)10-11-21)12-17(13)23-18(24)9-5-14-3-6-15(20)7-4-14/h2-9,12H,10-11,21H2,1H3,(H,22,25)(H,23,24)/b9-5+ |
| InChIKey | NSCPPLQLOCWRAR-WEVVVXLNSA-N |
| XLogP | 3.07 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|