C22H19FN4O2 — CID 67494098
(Z)-N-[5-[(4-fluorophenyl)carbamoylamino]-2-methylphenyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 67494098) has the molecular formula C22H19FN4O2 and a molecular weight of 390.42 g/mol. Its IUPAC name is (Z)-N-[5-[(4-fluorophenyl)carbamoylamino]-2-methylphenyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (Z)-N-[5-[(4-fluorophenyl)carbamoylamino]-2-methylphenyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 67494098 |
| Molecular Formula | C22H19FN4O2 |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | (Z)-N-[5-[(4-fluorophenyl)carbamoylamino]-2-methylphenyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | Cc1ccc(NC(=O)Nc2ccc(F)cc2)cc1NC(=O)/C=C\c1cccnc1 |
| InChI | InChI=1S/C22H19FN4O2/c1-15-4-8-19(26-22(29)25-18-9-6-17(23)7-10-18)13-20(15)27-21(28)11-5-16-3-2-12-24-14-16/h2-14H,1H3,(H,27,28)(H2,25,26,29)/b11-5- |
| InChIKey | MCUCIKDJOKBPOH-WZUFQYTHSA-N |
| XLogP | 4.83 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|