C22H18ClFN4O2 — CID 67494435
(Z)-N-[5-[(3-chloro-4-fluorophenyl)carbamoylamino]-2-methylphenyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 67494435) has the molecular formula C22H18ClFN4O2 and a molecular weight of 424.86 g/mol. Its IUPAC name is (Z)-N-[5-[(3-chloro-4-fluorophenyl)carbamoylamino]-2-methylphenyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (Z)-N-[5-[(3-chloro-4-fluorophenyl)carbamoylamino]-2-methylphenyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 67494435 |
| Molecular Formula | C22H18ClFN4O2 |
| Molecular Weight | 424.86 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | (Z)-N-[5-[(3-chloro-4-fluorophenyl)carbamoylamino]-2-methylphenyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | Cc1ccc(NC(=O)Nc2ccc(F)c(Cl)c2)cc1NC(=O)/C=C\c1cccnc1 |
| InChI | InChI=1S/C22H18ClFN4O2/c1-14-4-6-17(27-22(30)26-16-7-8-19(24)18(23)11-16)12-20(14)28-21(29)9-5-15-3-2-10-25-13-15/h2-13H,1H3,(H,28,29)(H2,26,27,30)/b9-5- |
| InChIKey | PNIQOGPUOQSRGJ-UITAMQMPSA-N |
| XLogP | 5.48 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.86 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|