C24H19BrF3N3O2 — CID 67494075
4-(bromomethyl)-N-[4-methyl-3-(3-pyridin-3-ylprop-2-enoylamino)phenyl]-3-(trifluoromethyl)benzamide (PubChem CID 67494075) has the molecular formula C24H19BrF3N3O2 and a molecular weight of 518.33 g/mol. Its IUPAC name is 4-(bromomethyl)-N-[4-methyl-3-(3-pyridin-3-ylprop-2-enoylamino)phenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | 4-(bromomethyl)-N-[4-methyl-3-(3-pyridin-3-ylprop-2-enoylamino)phenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 67494075 |
| Molecular Formula | C24H19BrF3N3O2 |
| Molecular Weight | 518.33 g/mol |
| Exact Mass | 517.06 |
| IUPAC Name | 4-(bromomethyl)-N-[4-methyl-3-(3-pyridin-3-ylprop-2-enoylamino)phenyl]-3-(trifluoromethyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(CBr)c(C(F)(F)F)c2)cc1NC(=O)C=Cc1cccnc1 |
| InChI | InChI=1S/C24H19BrF3N3O2/c1-15-4-8-19(12-21(15)31-22(32)9-5-16-3-2-10-29-14-16)30-23(33)17-6-7-18(13-25)20(11-17)24(26,27)28/h2-12,14H,13H2,1H3,(H,30,33)(H,31,32) |
| InChIKey | OJLINNLVESINBH-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.33 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|