C28H31N5O2 — CID 66552788
4-methyl-N-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-3-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]benzamide (PubChem CID 66552788) has the molecular formula C28H31N5O2 and a molecular weight of 469.59 g/mol. Its IUPAC name is 4-methyl-N-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-3-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]benzamide.
| Compound Name | 4-methyl-N-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-3-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]benzamide |
|---|---|
| PubChem CID | 66552788 |
| Molecular Formula | C28H31N5O2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | 4-methyl-N-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-3-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(CN3CCN(C)CC3)cc2)cc1NC(=O)/C=C/c1cccnc1 |
| InChI | InChI=1S/C28H31N5O2/c1-21-5-9-24(18-26(21)31-27(34)12-8-22-4-3-13-29-19-22)28(35)30-25-10-6-23(7-11-25)20-33-16-14-32(2)15-17-33/h3-13,18-19H,14-17,20H2,1-2H3,(H,30,35)(H,31,34)/b12-8+ |
| InChIKey | ZYUTZCGOMOMKAJ-XYOKQWHBSA-N |
| XLogP | 4.04 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|