C28H32N6OS — CID 143003623
4-[(4-methylpiperazin-1-yl)methyl]-N-[4-methyl-3-(1-pyridin-3-ylethenylcarbamothioylamino)phenyl]benzamide (PubChem CID 143003623) has the molecular formula C28H32N6OS and a molecular weight of 500.67 g/mol. Its IUPAC name is 4-[(4-methylpiperazin-1-yl)methyl]-N-[4-methyl-3-(1-pyridin-3-ylethenylcarbamothioylamino)phenyl]benzamide.
| Compound Name | 4-[(4-methylpiperazin-1-yl)methyl]-N-[4-methyl-3-(1-pyridin-3-ylethenylcarbamothioylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 143003623 |
| Molecular Formula | C28H32N6OS |
| Molecular Weight | 500.67 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | 4-[(4-methylpiperazin-1-yl)methyl]-N-[4-methyl-3-(1-pyridin-3-ylethenylcarbamothioylamino)phenyl]benzamide |
| SMILES | C=C(NC(=S)Nc1cc(NC(=O)c2ccc(CN3CCN(C)CC3)cc2)ccc1C)c1cccnc1 |
| InChI | InChI=1S/C28H32N6OS/c1-20-6-11-25(17-26(20)32-28(36)30-21(2)24-5-4-12-29-18-24)31-27(35)23-9-7-22(8-10-23)19-34-15-13-33(3)14-16-34/h4-12,17-18H,2,13-16,19H2,1,3H3,(H,31,35)(H2,30,32,36) |
| InChIKey | WEKLJEFPNYXRFR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.67 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|