C31H36ClN7O — CID 173468352
N-[3-[1-[[(Z)-3-amino-1-pyridin-3-ylprop-2-enylidene]amino]ethenyl-(chloromethyl)amino]-4-methylphenyl]-4-[(4-methylpiperazin-1-yl)methyl]benzamide (PubChem CID 173468352) has the molecular formula C31H36ClN7O and a molecular weight of 558.13 g/mol. Its IUPAC name is N-[3-[1-[[(Z)-3-amino-1-pyridin-3-ylprop-2-enylidene]amino]ethenyl-(chloromethyl)amino]-4-methylphenyl]-4-[(4-methylpiperazin-1-yl)methyl]benzamide.
| Compound Name | N-[3-[1-[[(Z)-3-amino-1-pyridin-3-ylprop-2-enylidene]amino]ethenyl-(chloromethyl)amino]-4-methylphenyl]-4-[(4-methylpiperazin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 173468352 |
| Molecular Formula | C31H36ClN7O |
| Molecular Weight | 558.13 g/mol |
| Exact Mass | 557.27 |
| IUPAC Name | N-[3-[1-[[(Z)-3-amino-1-pyridin-3-ylprop-2-enylidene]amino]ethenyl-(chloromethyl)amino]-4-methylphenyl]-4-[(4-methylpiperazin-1-yl)methyl]benzamide |
| SMILES | C=C(N=C(/C=C\N)c1cccnc1)N(CCl)c1cc(NC(=O)c2ccc(CN3CCN(C)CC3)cc2)ccc1C |
| InChI | InChI=1S/C31H36ClN7O/c1-23-6-11-28(36-31(40)26-9-7-25(8-10-26)21-38-17-15-37(3)16-18-38)19-30(23)39(22-32)24(2)35-29(12-13-33)27-5-4-14-34-20-27/h4-14,19-20H,2,15-18,21-22,33H2,1,3H3,(H,36,40)/b13-12-,35-29? |
| InChIKey | LUZSZDSTXXELSX-IIBIFTLMSA-N |
| XLogP | 4.83 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.13 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|