C26H27Cl2N5O2 — CID 18422103
2,6-dichloro-N-[4-methyl-3-[[3-[(4-methylpiperazin-1-yl)methyl]benzoyl]amino]phenyl]pyridine-4-carboxamide (PubChem CID 18422103) has the molecular formula C26H27Cl2N5O2 and a molecular weight of 512.44 g/mol. Its IUPAC name is 2,6-dichloro-N-[4-methyl-3-[[3-[(4-methylpiperazin-1-yl)methyl]benzoyl]amino]phenyl]pyridine-4-carboxamide.
| Compound Name | 2,6-dichloro-N-[4-methyl-3-[[3-[(4-methylpiperazin-1-yl)methyl]benzoyl]amino]phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 18422103 |
| Molecular Formula | C26H27Cl2N5O2 |
| Molecular Weight | 512.44 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | 2,6-dichloro-N-[4-methyl-3-[[3-[(4-methylpiperazin-1-yl)methyl]benzoyl]amino]phenyl]pyridine-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc(Cl)nc(Cl)c2)cc1NC(=O)c1cccc(CN2CCN(C)CC2)c1 |
| InChI | InChI=1S/C26H27Cl2N5O2/c1-17-6-7-21(29-26(35)20-13-23(27)31-24(28)14-20)15-22(17)30-25(34)19-5-3-4-18(12-19)16-33-10-8-32(2)9-11-33/h3-7,12-15H,8-11,16H2,1-2H3,(H,29,35)(H,30,34) |
| InChIKey | CXTCQTVJBNGRPJ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|