C31H37N5O3 — CID 22636122
4-methyl-3-[[3-[(4-methylpiperazin-1-yl)methyl]benzoyl]amino]-N-(3-morpholin-4-ylphenyl)benzamide (PubChem CID 22636122) has the molecular formula C31H37N5O3 and a molecular weight of 527.67 g/mol. Its IUPAC name is 4-methyl-3-[[3-[(4-methylpiperazin-1-yl)methyl]benzoyl]amino]-N-(3-morpholin-4-ylphenyl)benzamide.
| Compound Name | 4-methyl-3-[[3-[(4-methylpiperazin-1-yl)methyl]benzoyl]amino]-N-(3-morpholin-4-ylphenyl)benzamide |
|---|---|
| PubChem CID | 22636122 |
| Molecular Formula | C31H37N5O3 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.29 |
| IUPAC Name | 4-methyl-3-[[3-[(4-methylpiperazin-1-yl)methyl]benzoyl]amino]-N-(3-morpholin-4-ylphenyl)benzamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(N3CCOCC3)c2)cc1NC(=O)c1cccc(CN2CCN(C)CC2)c1 |
| InChI | InChI=1S/C31H37N5O3/c1-23-9-10-26(30(37)32-27-7-4-8-28(21-27)36-15-17-39-18-16-36)20-29(23)33-31(38)25-6-3-5-24(19-25)22-35-13-11-34(2)12-14-35/h3-10,19-21H,11-18,22H2,1-2H3,(H,32,37)(H,33,38) |
| InChIKey | XVZJLSUIOGRPOW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_I(4)', 'substructure': 'N/A'} |
|---|