C26H28N4O5S — CID 22291112
3-(methanesulfonamido)-N-[2-methyl-5-[(3-morpholin-4-ylbenzoyl)amino]phenyl]benzamide (PubChem CID 22291112) has the molecular formula C26H28N4O5S and a molecular weight of 508.60 g/mol. Its IUPAC name is 3-(methanesulfonamido)-N-[2-methyl-5-[(3-morpholin-4-ylbenzoyl)amino]phenyl]benzamide.
| Compound Name | 3-(methanesulfonamido)-N-[2-methyl-5-[(3-morpholin-4-ylbenzoyl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 22291112 |
| Molecular Formula | C26H28N4O5S |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | 3-(methanesulfonamido)-N-[2-methyl-5-[(3-morpholin-4-ylbenzoyl)amino]phenyl]benzamide |
| SMILES | Cc1ccc(NC(=O)c2cccc(N3CCOCC3)c2)cc1NC(=O)c1cccc(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C26H28N4O5S/c1-18-9-10-21(27-25(31)20-6-4-8-23(16-20)30-11-13-35-14-12-30)17-24(18)28-26(32)19-5-3-7-22(15-19)29-36(2,33)34/h3-10,15-17,29H,11-14H2,1-2H3,(H,27,31)(H,28,32) |
| InChIKey | OVQAEFHPMPROSC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |