C30H34N4O3 — CID 142647198
N-[2-methyl-5-[(3-morpholin-4-ylbenzoyl)amino]phenyl]-3-piperidin-4-ylbenzamide (PubChem CID 142647198) has the molecular formula C30H34N4O3 and a molecular weight of 498.63 g/mol. Its IUPAC name is N-[2-methyl-5-[(3-morpholin-4-ylbenzoyl)amino]phenyl]-3-piperidin-4-ylbenzamide.
| Compound Name | N-[2-methyl-5-[(3-morpholin-4-ylbenzoyl)amino]phenyl]-3-piperidin-4-ylbenzamide |
|---|---|
| PubChem CID | 142647198 |
| Molecular Formula | C30H34N4O3 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | N-[2-methyl-5-[(3-morpholin-4-ylbenzoyl)amino]phenyl]-3-piperidin-4-ylbenzamide |
| SMILES | Cc1ccc(NC(=O)c2cccc(N3CCOCC3)c2)cc1NC(=O)c1cccc(C2CCNCC2)c1 |
| InChI | InChI=1S/C30H34N4O3/c1-21-8-9-26(32-29(35)25-6-3-7-27(19-25)34-14-16-37-17-15-34)20-28(21)33-30(36)24-5-2-4-23(18-24)22-10-12-31-13-11-22/h2-9,18-20,22,31H,10-17H2,1H3,(H,32,35)(H,33,36) |
| InChIKey | LSLHKFFOYCIAMK-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |