C29H36N4O2 — CID 70208034
3-[4-(diethylaminomethyl)anilino]-4-methyl-N-(3-morpholin-4-ylphenyl)benzamide (PubChem CID 70208034) has the molecular formula C29H36N4O2 and a molecular weight of 472.63 g/mol. Its IUPAC name is 3-[4-(diethylaminomethyl)anilino]-4-methyl-N-(3-morpholin-4-ylphenyl)benzamide.
| Compound Name | 3-[4-(diethylaminomethyl)anilino]-4-methyl-N-(3-morpholin-4-ylphenyl)benzamide |
|---|---|
| PubChem CID | 70208034 |
| Molecular Formula | C29H36N4O2 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | 3-[4-(diethylaminomethyl)anilino]-4-methyl-N-(3-morpholin-4-ylphenyl)benzamide |
| SMILES | CCN(CC)Cc1ccc(Nc2cc(C(=O)Nc3cccc(N4CCOCC4)c3)ccc2C)cc1 |
| InChI | InChI=1S/C29H36N4O2/c1-4-32(5-2)21-23-10-13-25(14-11-23)30-28-19-24(12-9-22(28)3)29(34)31-26-7-6-8-27(20-26)33-15-17-35-18-16-33/h6-14,19-20,30H,4-5,15-18,21H2,1-3H3,(H,31,34) |
| InChIKey | KOSXZQBUPDLSHX-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_I(4)', 'substructure': 'N/A'} |
|---|