C30H35N5O5 — CID 22291010
N-[3-[[4-(diethylaminomethyl)benzoyl]amino]-4-methylphenyl]-3-morpholin-4-yl-2-nitrobenzamide (PubChem CID 22291010) has the molecular formula C30H35N5O5 and a molecular weight of 545.64 g/mol. Its IUPAC name is N-[3-[[4-(diethylaminomethyl)benzoyl]amino]-4-methylphenyl]-3-morpholin-4-yl-2-nitrobenzamide.
| Compound Name | N-[3-[[4-(diethylaminomethyl)benzoyl]amino]-4-methylphenyl]-3-morpholin-4-yl-2-nitrobenzamide |
|---|---|
| PubChem CID | 22291010 |
| Molecular Formula | C30H35N5O5 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.26 |
| IUPAC Name | N-[3-[[4-(diethylaminomethyl)benzoyl]amino]-4-methylphenyl]-3-morpholin-4-yl-2-nitrobenzamide |
| SMILES | CCN(CC)Cc1ccc(C(=O)Nc2cc(NC(=O)c3cccc(N4CCOCC4)c3[N+](=O)[O-])ccc2C)cc1 |
| InChI | InChI=1S/C30H35N5O5/c1-4-33(5-2)20-22-10-12-23(13-11-22)29(36)32-26-19-24(14-9-21(26)3)31-30(37)25-7-6-8-27(28(25)35(38)39)34-15-17-40-18-16-34/h6-14,19H,4-5,15-18,20H2,1-3H3,(H,31,37)(H,32,36) |
| InChIKey | MXCNWNGGJSFTJI-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 117.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|