C29H33N7O5 — CID 174376004
N-[4-methyl-3-[[3-(4-methylpiperazin-1-yl)-2-nitrobenzoyl]amino]phenyl]-2-morpholin-2-ylpyridine-4-carboxamide (PubChem CID 174376004) has the molecular formula C29H33N7O5 and a molecular weight of 559.63 g/mol. Its IUPAC name is N-[4-methyl-3-[[3-(4-methylpiperazin-1-yl)-2-nitrobenzoyl]amino]phenyl]-2-morpholin-2-ylpyridine-4-carboxamide.
| Compound Name | N-[4-methyl-3-[[3-(4-methylpiperazin-1-yl)-2-nitrobenzoyl]amino]phenyl]-2-morpholin-2-ylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 174376004 |
| Molecular Formula | C29H33N7O5 |
| Molecular Weight | 559.63 g/mol |
| Exact Mass | 559.25 |
| IUPAC Name | N-[4-methyl-3-[[3-(4-methylpiperazin-1-yl)-2-nitrobenzoyl]amino]phenyl]-2-morpholin-2-ylpyridine-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccnc(C3CNCCO3)c2)cc1NC(=O)c1cccc(N2CCN(C)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C29H33N7O5/c1-19-6-7-21(32-28(37)20-8-9-31-24(16-20)26-18-30-10-15-41-26)17-23(19)33-29(38)22-4-3-5-25(27(22)36(39)40)35-13-11-34(2)12-14-35/h3-9,16-17,26,30H,10-15,18H2,1-2H3,(H,32,37)(H,33,38) |
| InChIKey | VAMIOHSYWFAPFE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 141.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.63 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|