C29H35N7O3 — CID 174375396
N-[3-[[2-amino-5-(4-methylpiperazin-1-yl)benzoyl]amino]-4-methylphenyl]-N-morpholin-2-ylpyridine-4-carboxamide (PubChem CID 174375396) has the molecular formula C29H35N7O3 and a molecular weight of 529.65 g/mol. Its IUPAC name is N-[3-[[2-amino-5-(4-methylpiperazin-1-yl)benzoyl]amino]-4-methylphenyl]-N-morpholin-2-ylpyridine-4-carboxamide.
| Compound Name | N-[3-[[2-amino-5-(4-methylpiperazin-1-yl)benzoyl]amino]-4-methylphenyl]-N-morpholin-2-ylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 174375396 |
| Molecular Formula | C29H35N7O3 |
| Molecular Weight | 529.65 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | N-[3-[[2-amino-5-(4-methylpiperazin-1-yl)benzoyl]amino]-4-methylphenyl]-N-morpholin-2-ylpyridine-4-carboxamide |
| SMILES | Cc1ccc(N(C(=O)c2ccncc2)C2CNCCO2)cc1NC(=O)c1cc(N2CCN(C)CC2)ccc1N |
| InChI | InChI=1S/C29H35N7O3/c1-20-3-4-23(36(27-19-32-11-16-39-27)29(38)21-7-9-31-10-8-21)18-26(20)33-28(37)24-17-22(5-6-25(24)30)35-14-12-34(2)13-15-35/h3-10,17-18,27,32H,11-16,19,30H2,1-2H3,(H,33,37) |
| InChIKey | SEQDYWFCPAUAGQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.65 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|