C26H27ClN4O4 — CID 22291023
3-chloro-N-[3-[[4-(diethylaminomethyl)benzoyl]amino]-4-methylphenyl]-2-nitrobenzamide (PubChem CID 22291023) has the molecular formula C26H27ClN4O4 and a molecular weight of 494.98 g/mol. Its IUPAC name is 3-chloro-N-[3-[[4-(diethylaminomethyl)benzoyl]amino]-4-methylphenyl]-2-nitrobenzamide.
| Compound Name | 3-chloro-N-[3-[[4-(diethylaminomethyl)benzoyl]amino]-4-methylphenyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 22291023 |
| Molecular Formula | C26H27ClN4O4 |
| Molecular Weight | 494.98 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | 3-chloro-N-[3-[[4-(diethylaminomethyl)benzoyl]amino]-4-methylphenyl]-2-nitrobenzamide |
| SMILES | CCN(CC)Cc1ccc(C(=O)Nc2cc(NC(=O)c3cccc(Cl)c3[N+](=O)[O-])ccc2C)cc1 |
| InChI | InChI=1S/C26H27ClN4O4/c1-4-30(5-2)16-18-10-12-19(13-11-18)25(32)29-23-15-20(14-9-17(23)3)28-26(33)21-7-6-8-22(27)24(21)31(34)35/h6-15H,4-5,16H2,1-3H3,(H,28,33)(H,29,32) |
| InChIKey | UWWUHKXYZRVHTK-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.98 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|