C20H22N2O — CID 46426668
4-(diethylaminomethyl)-N-(3-ethynylphenyl)benzamide (PubChem CID 46426668) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is 4-(diethylaminomethyl)-N-(3-ethynylphenyl)benzamide.
| Compound Name | 4-(diethylaminomethyl)-N-(3-ethynylphenyl)benzamide |
|---|---|
| PubChem CID | 46426668 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 4-(diethylaminomethyl)-N-(3-ethynylphenyl)benzamide |
| SMILES | C#Cc1cccc(NC(=O)c2ccc(CN(CC)CC)cc2)c1 |
| InChI | InChI=1S/C20H22N2O/c1-4-16-8-7-9-19(14-16)21-20(23)18-12-10-17(11-13-18)15-22(5-2)6-3/h1,7-14H,5-6,15H2,2-3H3,(H,21,23) |
| InChIKey | NKAPFQNWSWDXNT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|