C26H25F4N3O2 — CID 55765297
N-[4-[[4-(diethylaminomethyl)benzoyl]amino]-3-(trifluoromethyl)phenyl]-2-fluorobenzamide (PubChem CID 55765297) has the molecular formula C26H25F4N3O2 and a molecular weight of 487.50 g/mol. Its IUPAC name is N-[4-[[4-(diethylaminomethyl)benzoyl]amino]-3-(trifluoromethyl)phenyl]-2-fluorobenzamide.
| Compound Name | N-[4-[[4-(diethylaminomethyl)benzoyl]amino]-3-(trifluoromethyl)phenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 55765297 |
| Molecular Formula | C26H25F4N3O2 |
| Molecular Weight | 487.50 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | N-[4-[[4-(diethylaminomethyl)benzoyl]amino]-3-(trifluoromethyl)phenyl]-2-fluorobenzamide |
| SMILES | CCN(CC)Cc1ccc(C(=O)Nc2ccc(NC(=O)c3ccccc3F)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H25F4N3O2/c1-3-33(4-2)16-17-9-11-18(12-10-17)24(34)32-23-14-13-19(15-21(23)26(28,29)30)31-25(35)20-7-5-6-8-22(20)27/h5-15H,3-4,16H2,1-2H3,(H,31,35)(H,32,34) |
| InChIKey | IBGKMHFRXVPCGH-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.50 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |