C23H14F4N2O2S — CID 52638821
N-[4-[(2-fluorobenzoyl)amino]-2-(trifluoromethyl)phenyl]-1-benzothiophene-2-carboxamide (PubChem CID 52638821) has the molecular formula C23H14F4N2O2S and a molecular weight of 458.44 g/mol. Its IUPAC name is N-[4-[(2-fluorobenzoyl)amino]-2-(trifluoromethyl)phenyl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-[4-[(2-fluorobenzoyl)amino]-2-(trifluoromethyl)phenyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 52638821 |
| Molecular Formula | C23H14F4N2O2S |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | N-[4-[(2-fluorobenzoyl)amino]-2-(trifluoromethyl)phenyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(NC(=O)c2ccccc2F)cc1C(F)(F)F)c1cc2ccccc2s1 |
| InChI | InChI=1S/C23H14F4N2O2S/c24-17-7-3-2-6-15(17)21(30)28-14-9-10-18(16(12-14)23(25,26)27)29-22(31)20-11-13-5-1-4-8-19(13)32-20/h1-12H,(H,28,30)(H,29,31) |
| InChIKey | ZWIWGWRFWBHDGQ-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |