C23H14F6N2O2 — CID 55765591
N-[4-[[(E)-3-(2,6-difluorophenyl)prop-2-enoyl]amino]-3-(trifluoromethyl)phenyl]-2-fluorobenzamide (PubChem CID 55765591) has the molecular formula C23H14F6N2O2 and a molecular weight of 464.37 g/mol. Its IUPAC name is N-[4-[[(E)-3-(2,6-difluorophenyl)prop-2-enoyl]amino]-3-(trifluoromethyl)phenyl]-2-fluorobenzamide.
| Compound Name | N-[4-[[(E)-3-(2,6-difluorophenyl)prop-2-enoyl]amino]-3-(trifluoromethyl)phenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 55765591 |
| Molecular Formula | C23H14F6N2O2 |
| Molecular Weight | 464.37 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | N-[4-[[(E)-3-(2,6-difluorophenyl)prop-2-enoyl]amino]-3-(trifluoromethyl)phenyl]-2-fluorobenzamide |
| SMILES | O=C(/C=C/c1c(F)cccc1F)Nc1ccc(NC(=O)c2ccccc2F)cc1C(F)(F)F |
| InChI | InChI=1S/C23H14F6N2O2/c24-17-6-3-7-18(25)14(17)9-11-21(32)31-20-10-8-13(12-16(20)23(27,28)29)30-22(33)15-4-1-2-5-19(15)26/h1-12H,(H,30,33)(H,31,32)/b11-9+ |
| InChIKey | MXRISVLSFLLWHM-PKNBQFBNSA-N |
| XLogP | 6.03 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.37 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|