C20H14F4N2O2S — CID 55765460
N-[4-[(2-fluorobenzoyl)amino]-2-(trifluoromethyl)phenyl]-3-methylthiophene-2-carboxamide (PubChem CID 55765460) has the molecular formula C20H14F4N2O2S and a molecular weight of 422.40 g/mol. Its IUPAC name is N-[4-[(2-fluorobenzoyl)amino]-2-(trifluoromethyl)phenyl]-3-methylthiophene-2-carboxamide.
| Compound Name | N-[4-[(2-fluorobenzoyl)amino]-2-(trifluoromethyl)phenyl]-3-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 55765460 |
| Molecular Formula | C20H14F4N2O2S |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | N-[4-[(2-fluorobenzoyl)amino]-2-(trifluoromethyl)phenyl]-3-methylthiophene-2-carboxamide |
| SMILES | Cc1ccsc1C(=O)Nc1ccc(NC(=O)c2ccccc2F)cc1C(F)(F)F |
| InChI | InChI=1S/C20H14F4N2O2S/c1-11-8-9-29-17(11)19(28)26-16-7-6-12(10-14(16)20(22,23)24)25-18(27)13-4-2-3-5-15(13)21/h2-10H,1H3,(H,25,27)(H,26,28) |
| InChIKey | MQVGEQQKBSKRNV-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |