C13H9ClF3NOS — CID 2546301
N-[4-chloro-3-(trifluoromethyl)phenyl]-3-methylthiophene-2-carboxamide (PubChem CID 2546301) has the molecular formula C13H9ClF3NOS and a molecular weight of 319.74 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-3-methylthiophene-2-carboxamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-3-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 2546301 |
| Molecular Formula | C13H9ClF3NOS |
| Molecular Weight | 319.74 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-3-methylthiophene-2-carboxamide |
| SMILES | Cc1ccsc1C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H9ClF3NOS/c1-7-4-5-20-11(7)12(19)18-8-2-3-10(14)9(6-8)13(15,16)17/h2-6H,1H3,(H,18,19) |
| InChIKey | CNIWRFVUDQMVKF-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.74 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |