C11H7ClF3N3OS — CID 7576779
N-[4-chloro-3-(trifluoromethyl)phenyl]-4-methylthiadiazole-5-carboxamide (PubChem CID 7576779) has the molecular formula C11H7ClF3N3OS and a molecular weight of 321.71 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-4-methylthiadiazole-5-carboxamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-4-methylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 7576779 |
| Molecular Formula | C11H7ClF3N3OS |
| Molecular Weight | 321.71 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-4-methylthiadiazole-5-carboxamide |
| SMILES | Cc1nnsc1C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H7ClF3N3OS/c1-5-9(20-18-17-5)10(19)16-6-2-3-8(12)7(4-6)11(13,14)15/h2-4H,1H3,(H,16,19) |
| InChIKey | QYONJCSAFBUBFO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.71 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |