C11H7F3N4O3S — CID 17013766
4-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]thiadiazole-5-carboxamide (PubChem CID 17013766) has the molecular formula C11H7F3N4O3S and a molecular weight of 332.26 g/mol. Its IUPAC name is 4-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]thiadiazole-5-carboxamide.
| Compound Name | 4-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17013766 |
| Molecular Formula | C11H7F3N4O3S |
| Molecular Weight | 332.26 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 4-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]thiadiazole-5-carboxamide |
| SMILES | Cc1nnsc1C(=O)Nc1ccc([N+](=O)[O-])c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H7F3N4O3S/c1-5-9(22-17-16-5)10(19)15-6-2-3-8(18(20)21)7(4-6)11(12,13)14/h2-4H,1H3,(H,15,19) |
| InChIKey | RRQCYWAELREYPE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.26 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|