C16H12BrF3N2O5 — CID 112807205
4-bromo-3,5-dimethoxy-N-[4-nitro-3-(trifluoromethyl)phenyl]benzamide (PubChem CID 112807205) has the molecular formula C16H12BrF3N2O5 and a molecular weight of 449.18 g/mol. Its IUPAC name is 4-bromo-3,5-dimethoxy-N-[4-nitro-3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-bromo-3,5-dimethoxy-N-[4-nitro-3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 112807205 |
| Molecular Formula | C16H12BrF3N2O5 |
| Molecular Weight | 449.18 g/mol |
| Exact Mass | 447.99 |
| IUPAC Name | 4-bromo-3,5-dimethoxy-N-[4-nitro-3-(trifluoromethyl)phenyl]benzamide |
| SMILES | COc1cc(C(=O)Nc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)cc(OC)c1Br |
| InChI | InChI=1S/C16H12BrF3N2O5/c1-26-12-5-8(6-13(27-2)14(12)17)15(23)21-9-3-4-11(22(24)25)10(7-9)16(18,19)20/h3-7H,1-2H3,(H,21,23) |
| InChIKey | APYXOIGDHIZYMF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.18 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|