C11H10BrF3N2O3 — CID 142684017
(2R)-3-bromo-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide (PubChem CID 142684017) has the molecular formula C11H10BrF3N2O3 and a molecular weight of 355.11 g/mol. Its IUPAC name is (2R)-3-bromo-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | (2R)-3-bromo-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 142684017 |
| Molecular Formula | C11H10BrF3N2O3 |
| Molecular Weight | 355.11 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | (2R)-3-bromo-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide |
| SMILES | C[C@@H](CBr)C(=O)Nc1ccc([N+](=O)[O-])c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H10BrF3N2O3/c1-6(5-12)10(18)16-7-2-3-9(17(19)20)8(4-7)11(13,14)15/h2-4,6H,5H2,1H3,(H,16,18)/t6-/m0/s1 |
| InChIKey | DWDHAGVUOJMNAD-LURJTMIESA-N |
| XLogP | 3.58 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.11 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|