C17H14F4N2O3S — CID 143036883
3-(4-fluorophenyl)sulfanyl-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide (PubChem CID 143036883) has the molecular formula C17H14F4N2O3S and a molecular weight of 402.37 g/mol. Its IUPAC name is 3-(4-fluorophenyl)sulfanyl-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-(4-fluorophenyl)sulfanyl-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 143036883 |
| Molecular Formula | C17H14F4N2O3S |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 3-(4-fluorophenyl)sulfanyl-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(CSc1ccc(F)cc1)C(=O)Nc1ccc([N+](=O)[O-])c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H14F4N2O3S/c1-10(9-27-13-5-2-11(18)3-6-13)16(24)22-12-4-7-15(23(25)26)14(8-12)17(19,20)21/h2-8,10H,9H2,1H3,(H,22,24) |
| InChIKey | GNFQGDSMFOLXHL-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|