C17H15F4NOS — CID 144981955
3-(4-fluorophenyl)sulfanyl-2-methyl-N-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 144981955) has the molecular formula C17H15F4NOS and a molecular weight of 357.37 g/mol. Its IUPAC name is 3-(4-fluorophenyl)sulfanyl-2-methyl-N-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-(4-fluorophenyl)sulfanyl-2-methyl-N-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 144981955 |
| Molecular Formula | C17H15F4NOS |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 3-(4-fluorophenyl)sulfanyl-2-methyl-N-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(CSc1ccc(F)cc1)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H15F4NOS/c1-11(10-24-15-7-5-13(18)6-8-15)16(23)22-14-4-2-3-12(9-14)17(19,20)21/h2-9,11H,10H2,1H3,(H,22,23) |
| InChIKey | AJHNEPRHUIZZTL-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |