C17H14F8N2O4S2 — CID 155518740
2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]sulfanylpropanamide (PubChem CID 155518740) has the molecular formula C17H14F8N2O4S2 and a molecular weight of 526.43 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]sulfanylpropanamide.
| Compound Name | 2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 155518740 |
| Molecular Formula | C17H14F8N2O4S2 |
| Molecular Weight | 526.43 g/mol |
| Exact Mass | 526.03 |
| IUPAC Name | 2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]sulfanylpropanamide |
| SMILES | CC(O)(CSc1ccc(S(F)(F)(F)(F)F)cc1)C(=O)Nc1ccc([N+](=O)[O-])c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H14F8N2O4S2/c1-16(29,9-32-11-3-5-12(6-4-11)33(21,22,23,24)25)15(28)26-10-2-7-14(27(30)31)13(8-10)17(18,19)20/h2-8,29H,9H2,1H3,(H,26,28) |
| InChIKey | GDRIHKFCGHRDLN-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.43 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|