C19H15F6N3O6 — CID 11294883
(2S)-2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]-3-[4-[(2,2,2-trifluoroacetyl)amino]phenoxy]propanamide (PubChem CID 11294883) has the molecular formula C19H15F6N3O6 and a molecular weight of 495.33 g/mol. Its IUPAC name is (2S)-2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]-3-[4-[(2,2,2-trifluoroacetyl)amino]phenoxy]propanamide.
| Compound Name | (2S)-2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]-3-[4-[(2,2,2-trifluoroacetyl)amino]phenoxy]propanamide |
|---|---|
| PubChem CID | 11294883 |
| Molecular Formula | C19H15F6N3O6 |
| Molecular Weight | 495.33 g/mol |
| Exact Mass | 495.09 |
| IUPAC Name | (2S)-2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]-3-[4-[(2,2,2-trifluoroacetyl)amino]phenoxy]propanamide |
| SMILES | C[C@](O)(COc1ccc(NC(=O)C(F)(F)F)cc1)C(=O)Nc1ccc([N+](=O)[O-])c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H15F6N3O6/c1-17(31,9-34-12-5-2-10(3-6-12)26-16(30)19(23,24)25)15(29)27-11-4-7-14(28(32)33)13(8-11)18(20,21)22/h2-8,31H,9H2,1H3,(H,26,30)(H,27,29)/t17-/m0/s1 |
| InChIKey | BOSPOUUMRHKAJO-KRWDZBQOSA-N |
| XLogP | 3.88 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|