C22H21F3FeN2O5+2 — CID 53376966
CID 53376966 (PubChem CID 53376966) has the molecular formula C22H21F3FeN2O5+2 and a molecular weight of 506.26 g/mol.
| Compound Name | CID 53376966 |
|---|---|
| PubChem CID | 53376966 |
| Molecular Formula | C22H21F3FeN2O5+2 |
| Molecular Weight | 506.26 g/mol |
| Exact Mass | 506.07 |
| IUPAC Name | — |
| SMILES | CC(O)(COC[C]1[CH][CH][CH][CH]1)C(=O)Nc1ccc([N+](=O)[O-])c(C(F)(F)F)c1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C17H16F3N2O5.C5H5.Fe/c1-16(24,10-27-9-11-4-2-3-5-11)15(23)21-12-6-7-14(22(25)26)13(8-12)17(18,19)20;1-2-4-5-3-1;/h2-8,24H,9-10H2,1H3,(H,21,23);1-5H;/q;;+2 |
| InChIKey | KKULCPFPTSYNHE-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.26 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|