C23H21F3FeN2O3+2 — CID 53377084
CID 53377084 (PubChem CID 53377084) has the molecular formula C23H21F3FeN2O3+2 and a molecular weight of 486.27 g/mol.
| Compound Name | CID 53377084 |
|---|---|
| PubChem CID | 53377084 |
| Molecular Formula | C23H21F3FeN2O3+2 |
| Molecular Weight | 486.27 g/mol |
| Exact Mass | 486.08 |
| IUPAC Name | — |
| SMILES | CC(O)(COC[C]1[CH][CH][CH][CH]1)C(=O)Nc1ccc(C#N)c(C(F)(F)F)c1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C18H16F3N2O3.C5H5.Fe/c1-17(25,11-26-10-12-4-2-3-5-12)16(24)23-14-7-6-13(9-22)15(8-14)18(19,20)21;1-2-4-5-3-1;/h2-8,25H,10-11H2,1H3,(H,23,24);1-5H;/q;;+2 |
| InChIKey | PSYPWLVABXCJKT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.27 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|