C17H15F3N2O6 — CID 123428105
2-hydroxy-3-(4-hydroxyphenoxy)-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide (PubChem CID 123428105) has the molecular formula C17H15F3N2O6 and a molecular weight of 400.31 g/mol. Its IUPAC name is 2-hydroxy-3-(4-hydroxyphenoxy)-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-hydroxy-3-(4-hydroxyphenoxy)-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 123428105 |
| Molecular Formula | C17H15F3N2O6 |
| Molecular Weight | 400.31 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 2-hydroxy-3-(4-hydroxyphenoxy)-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(O)(COc1ccc(O)cc1)C(=O)Nc1ccc([N+](=O)[O-])c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H15F3N2O6/c1-16(25,9-28-12-5-3-11(23)4-6-12)15(24)21-10-2-7-14(22(26)27)13(8-10)17(18,19)20/h2-8,23,25H,9H2,1H3,(H,21,24) |
| InChIKey | FSAVDMVHDRRSMP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|