C17H17ClN2O5 — CID 11979027
(2R)-3-(4-chlorophenoxy)-2-hydroxy-2-methyl-N-(3-methyl-4-nitrophenyl)propanamide (PubChem CID 11979027) has the molecular formula C17H17ClN2O5 and a molecular weight of 364.79 g/mol. Its IUPAC name is (2R)-3-(4-chlorophenoxy)-2-hydroxy-2-methyl-N-(3-methyl-4-nitrophenyl)propanamide.
| Compound Name | (2R)-3-(4-chlorophenoxy)-2-hydroxy-2-methyl-N-(3-methyl-4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 11979027 |
| Molecular Formula | C17H17ClN2O5 |
| Molecular Weight | 364.79 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | (2R)-3-(4-chlorophenoxy)-2-hydroxy-2-methyl-N-(3-methyl-4-nitrophenyl)propanamide |
| SMILES | Cc1cc(NC(=O)[C@](C)(O)COc2ccc(Cl)cc2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H17ClN2O5/c1-11-9-13(5-8-15(11)20(23)24)19-16(21)17(2,22)10-25-14-6-3-12(18)4-7-14/h3-9,22H,10H2,1-2H3,(H,19,21)/t17-/m1/s1 |
| InChIKey | CIGLDHBVHPQICW-QGZVFWFLSA-N |
| XLogP | 3.33 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.79 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|