C38H44N4O12 — CID 87877458
2-hydroxy-3-[4-(2-hydroxyethyl)phenoxy]-2-methyl-N-(3-methyl-4-nitrophenyl)propanamide (PubChem CID 87877458) has the molecular formula C38H44N4O12 and a molecular weight of 748.79 g/mol. Its IUPAC name is 2-hydroxy-3-[4-(2-hydroxyethyl)phenoxy]-2-methyl-N-(3-methyl-4-nitrophenyl)propanamide.
| Compound Name | 2-hydroxy-3-[4-(2-hydroxyethyl)phenoxy]-2-methyl-N-(3-methyl-4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 87877458 |
| Molecular Formula | C38H44N4O12 |
| Molecular Weight | 748.79 g/mol |
| Exact Mass | 748.30 |
| IUPAC Name | 2-hydroxy-3-[4-(2-hydroxyethyl)phenoxy]-2-methyl-N-(3-methyl-4-nitrophenyl)propanamide |
| SMILES | Cc1cc(NC(=O)C(C)(O)COc2ccc(CCO)cc2)ccc1[N+](=O)[O-].Cc1cc(NC(=O)C(C)(O)COc2ccc(CCO)cc2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/2C19H22N2O6/c2*1-13-11-15(5-8-17(13)21(25)26)20-18(23)19(2,24)12-27-16-6-3-14(4-7-16)9-10-22/h2*3-8,11,22,24H,9-10,12H2,1-2H3,(H,20,23) |
| InChIKey | GYCZVHLCOIHNHD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 243.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.79 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|