C18H17F3N2O6 — CID 67526286
2-hydroxy-2-methyl-N-(3-methyl-4-nitrophenyl)-3-[4-(trifluoromethoxy)phenoxy]propanamide (PubChem CID 67526286) has the molecular formula C18H17F3N2O6 and a molecular weight of 414.34 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-N-(3-methyl-4-nitrophenyl)-3-[4-(trifluoromethoxy)phenoxy]propanamide.
| Compound Name | 2-hydroxy-2-methyl-N-(3-methyl-4-nitrophenyl)-3-[4-(trifluoromethoxy)phenoxy]propanamide |
|---|---|
| PubChem CID | 67526286 |
| Molecular Formula | C18H17F3N2O6 |
| Molecular Weight | 414.34 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 2-hydroxy-2-methyl-N-(3-methyl-4-nitrophenyl)-3-[4-(trifluoromethoxy)phenoxy]propanamide |
| SMILES | Cc1cc(NC(=O)C(C)(O)COc2ccc(OC(F)(F)F)cc2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H17F3N2O6/c1-11-9-12(3-8-15(11)23(26)27)22-16(24)17(2,25)10-28-13-4-6-14(7-5-13)29-18(19,20)21/h3-9,25H,10H2,1-2H3,(H,22,24) |
| InChIKey | OKKRJMUAMSRYBZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|