C20H20F3N3O6 — CID 67526672
3-[4-acetamido-3-(trifluoromethyl)phenoxy]-2-hydroxy-2-methyl-N-(3-methyl-4-nitrophenyl)propanamide (PubChem CID 67526672) has the molecular formula C20H20F3N3O6 and a molecular weight of 455.39 g/mol. Its IUPAC name is 3-[4-acetamido-3-(trifluoromethyl)phenoxy]-2-hydroxy-2-methyl-N-(3-methyl-4-nitrophenyl)propanamide.
| Compound Name | 3-[4-acetamido-3-(trifluoromethyl)phenoxy]-2-hydroxy-2-methyl-N-(3-methyl-4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 67526672 |
| Molecular Formula | C20H20F3N3O6 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 3-[4-acetamido-3-(trifluoromethyl)phenoxy]-2-hydroxy-2-methyl-N-(3-methyl-4-nitrophenyl)propanamide |
| SMILES | CC(=O)Nc1ccc(OCC(C)(O)C(=O)Nc2ccc([N+](=O)[O-])c(C)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C20H20F3N3O6/c1-11-8-13(4-7-17(11)26(30)31)25-18(28)19(3,29)10-32-14-5-6-16(24-12(2)27)15(9-14)20(21,22)23/h4-9,29H,10H2,1-3H3,(H,24,27)(H,25,28) |
| InChIKey | HJSCLRPSXJAZRG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|