C18H16F4N2O5 — CID 143142158
2-[(4-fluorophenoxy)methyl]-3-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide (PubChem CID 143142158) has the molecular formula C18H16F4N2O5 and a molecular weight of 416.33 g/mol. Its IUPAC name is 2-[(4-fluorophenoxy)methyl]-3-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-[(4-fluorophenoxy)methyl]-3-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 143142158 |
| Molecular Formula | C18H16F4N2O5 |
| Molecular Weight | 416.33 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 2-[(4-fluorophenoxy)methyl]-3-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(CO)(COc1ccc(F)cc1)C(=O)Nc1ccc([N+](=O)[O-])c(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H16F4N2O5/c1-17(9-25,10-29-13-5-2-11(19)3-6-13)16(26)23-12-4-7-15(24(27)28)14(8-12)18(20,21)22/h2-8,25H,9-10H2,1H3,(H,23,26) |
| InChIKey | HBQDVXKRSOHJRI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.33 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|