C18H16F8N2O5S — CID 145082836
2-(hydroxymethyl)-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]-3-[3-(pentafluoro-λ6-sulfanyl)phenoxy]propanamide (PubChem CID 145082836) has the molecular formula C18H16F8N2O5S and a molecular weight of 524.39 g/mol. Its IUPAC name is 2-(hydroxymethyl)-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]-3-[3-(pentafluoro-λ6-sulfanyl)phenoxy]propanamide.
| Compound Name | 2-(hydroxymethyl)-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]-3-[3-(pentafluoro-λ6-sulfanyl)phenoxy]propanamide |
|---|---|
| PubChem CID | 145082836 |
| Molecular Formula | C18H16F8N2O5S |
| Molecular Weight | 524.39 g/mol |
| Exact Mass | 524.07 |
| IUPAC Name | 2-(hydroxymethyl)-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]-3-[3-(pentafluoro-λ6-sulfanyl)phenoxy]propanamide |
| SMILES | CC(CO)(COc1cccc(S(F)(F)(F)(F)F)c1)C(=O)Nc1ccc([N+](=O)[O-])c(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H16F8N2O5S/c1-17(9-29,10-33-12-3-2-4-13(8-12)34(22,23,24,25)26)16(30)27-11-5-6-15(28(31)32)14(7-11)18(19,20)21/h2-8,29H,9-10H2,1H3,(H,27,30) |
| InChIKey | QQZJPOGAYKLRCK-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.39 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|