C24H28F3N3O6 — CID 91594581
4-(4-acetamidophenoxy)-4-ethyl-2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]hexanamide (PubChem CID 91594581) has the molecular formula C24H28F3N3O6 and a molecular weight of 511.50 g/mol. Its IUPAC name is 4-(4-acetamidophenoxy)-4-ethyl-2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]hexanamide.
| Compound Name | 4-(4-acetamidophenoxy)-4-ethyl-2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]hexanamide |
|---|---|
| PubChem CID | 91594581 |
| Molecular Formula | C24H28F3N3O6 |
| Molecular Weight | 511.50 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | 4-(4-acetamidophenoxy)-4-ethyl-2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]hexanamide |
| SMILES | CCC(CC)(CC(C)(O)C(=O)Nc1ccc([N+](=O)[O-])c(C(F)(F)F)c1)Oc1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C24H28F3N3O6/c1-5-23(6-2,36-18-10-7-16(8-11-18)28-15(3)31)14-22(4,33)21(32)29-17-9-12-20(30(34)35)19(13-17)24(25,26)27/h7-13,33H,5-6,14H2,1-4H3,(H,28,31)(H,29,32) |
| InChIKey | IXYADJJDUDAJRQ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.50 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|