C17H15F3N2O4S — CID 20500896
2-hydroxy-2-(4-methylsulfanylphenyl)-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide (PubChem CID 20500896) has the molecular formula C17H15F3N2O4S and a molecular weight of 400.38 g/mol. Its IUPAC name is 2-hydroxy-2-(4-methylsulfanylphenyl)-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-hydroxy-2-(4-methylsulfanylphenyl)-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 20500896 |
| Molecular Formula | C17H15F3N2O4S |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 2-hydroxy-2-(4-methylsulfanylphenyl)-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide |
| SMILES | CSc1ccc(C(C)(O)C(=O)Nc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C17H15F3N2O4S/c1-16(24,10-3-6-12(27-2)7-4-10)15(23)21-11-5-8-14(22(25)26)13(9-11)17(18,19)20/h3-9,24H,1-2H3,(H,21,23) |
| InChIKey | FGEFBXMYXFOLAA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|