C19H16F6N2O4 — CID 59107792
(2S,4R)-2-hydroxy-N-[4-nitro-3-(trifluoromethyl)phenyl]-4-phenyl-2-(trifluoromethyl)pentanamide (PubChem CID 59107792) has the molecular formula C19H16F6N2O4 and a molecular weight of 450.34 g/mol. Its IUPAC name is (2S,4R)-2-hydroxy-N-[4-nitro-3-(trifluoromethyl)phenyl]-4-phenyl-2-(trifluoromethyl)pentanamide.
| Compound Name | (2S,4R)-2-hydroxy-N-[4-nitro-3-(trifluoromethyl)phenyl]-4-phenyl-2-(trifluoromethyl)pentanamide |
|---|---|
| PubChem CID | 59107792 |
| Molecular Formula | C19H16F6N2O4 |
| Molecular Weight | 450.34 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | (2S,4R)-2-hydroxy-N-[4-nitro-3-(trifluoromethyl)phenyl]-4-phenyl-2-(trifluoromethyl)pentanamide |
| SMILES | C[C@H](C[C@](O)(C(=O)Nc1ccc([N+](=O)[O-])c(C(F)(F)F)c1)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C19H16F6N2O4/c1-11(12-5-3-2-4-6-12)10-17(29,19(23,24)25)16(28)26-13-7-8-15(27(30)31)14(9-13)18(20,21)22/h2-9,11,29H,10H2,1H3,(H,26,28)/t11-,17+/m1/s1 |
| InChIKey | RETGATTXHQWSOT-DIFFPNOSSA-N |
| XLogP | 5.04 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.34 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|